C11H24N3O2+ — CID 6866633
6-[[(2E)-2-hydroxyiminoacetyl]amino]hexyl-trimethylazanium (PubChem CID 6866633) has the molecular formula C11H24N3O2+ and a molecular weight of 230.33 g/mol. Its IUPAC name is 6-[[(2E)-2-hydroxyiminoacetyl]amino]hexyl-trimethylazanium.
| Compound Name | 6-[[(2E)-2-hydroxyiminoacetyl]amino]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 6866633 |
| Molecular Formula | C11H24N3O2+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 6-[[(2E)-2-hydroxyiminoacetyl]amino]hexyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCCCNC(=O)/C=N/O |
| InChI | InChI=1S/C11H23N3O2/c1-14(2,3)9-7-5-4-6-8-12-11(15)10-13-16/h10H,4-9H2,1-3H3,(H-,12,15,16)/p+1 |
| InChIKey | TYCBGYJDMYWSFL-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|