C7H16N3O2+ — CID 28816307
2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl-trimethylazanium (PubChem CID 28816307) has the molecular formula C7H16N3O2+ and a molecular weight of 174.22 g/mol. Its IUPAC name is 2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 28816307 |
| Molecular Formula | C7H16N3O2+ |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-[[(2Z)-2-hydroxyiminoacetyl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNC(=O)/C=N\O |
| InChI | InChI=1S/C7H15N3O2/c1-10(2,3)5-4-8-7(11)6-9-12/h6H,4-5H2,1-3H3,(H-,8,11,12)/p+1 |
| InChIKey | XFUQAMIAEFTNLN-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|