C13H20IN3O2 — CID 17190134
benzyl-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethyl]-dimethylazanium iodide (PubChem CID 17190134) has the molecular formula C13H20IN3O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is benzyl-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethyl]-dimethylazanium iodide.
| Compound Name | benzyl-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 17190134 |
| Molecular Formula | C13H20IN3O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | benzyl-[2-[[(2E)-2-hydroxyiminoacetyl]amino]ethyl]-dimethylazanium iodide |
| SMILES | C[N+](C)(CCNC(=O)/C=N/O)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C13H19N3O2.HI/c1-16(2,9-8-14-13(17)10-15-18)11-12-6-4-3-5-7-12;/h3-7,10H,8-9,11H2,1-2H3,(H-,14,17,18);1H |
| InChIKey | SRSQBEOCAYHCAW-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|