C14H21NO3 — CID 87376454
benzyl-(2-hydroxyethyl)-dimethylazanium;prop-2-enoate (PubChem CID 87376454) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is benzyl-(2-hydroxyethyl)-dimethylazanium;prop-2-enoate.
| Compound Name | benzyl-(2-hydroxyethyl)-dimethylazanium;prop-2-enoate |
|---|---|
| PubChem CID | 87376454 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | benzyl-(2-hydroxyethyl)-dimethylazanium;prop-2-enoate |
| SMILES | C=CC(=O)[O-].C[N+](C)(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C11H18NO.C3H4O2/c1-12(2,8-9-13)10-11-6-4-3-5-7-11;1-2-3(4)5/h3-7,13H,8-10H2,1-2H3;2H,1H2,(H,4,5)/q+1;/p-1 |
| InChIKey | VMWXGNSUQDJGSQ-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|