About prop-2-enoate;trimethyl(phenyl)azanium
prop-2-enoate;trimethyl(phenyl)azanium (PubChem CID 126506580) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is prop-2-enoate;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | prop-2-enoate;trimethyl(phenyl)azanium |
| PubChem CID | 126506580 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | prop-2-enoate;trimethyl(phenyl)azanium |
| SMILES | C=CC(=O)[O-].C[N+](C)(C)c1ccccc1 |
| InChI | InChI=1S/C9H14N.C3H4O2/c1-10(2,3)9-7-5-4-6-8-9;1-2-3(4)5/h4-8H,1-3H3;2H,1H2,(H,4,5)/q+1;/p-1 |
| InChIKey | DGUTXSBBNRQOKD-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoate;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoate;trimethyl(phenyl)azanium?
The IUPAC name of prop-2-enoate;trimethyl(phenyl)azanium (CID 126506580) is prop-2-enoate;trimethyl(phenyl)azanium.
What is the SMILES notation for prop-2-enoate;trimethyl(phenyl)azanium?
The canonical SMILES for prop-2-enoate;trimethyl(phenyl)azanium is C=CC(=O)[O-].C[N+](C)(C)c1ccccc1.
What is the InChIKey of prop-2-enoate;trimethyl(phenyl)azanium?
The InChIKey is DGUTXSBBNRQOKD-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N.C3H4O2/c1-10(2,3)9-7-5-4-6-8-9;1-2-3(4)5/h4-8H,1-3H3;2H,1H2,(H,4,5)/q+1;/p-1.
What are the key properties of prop-2-enoate;trimethyl(phenyl)azanium?
prop-2-enoate;trimethyl(phenyl)azanium has a molecular weight of 207.27 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoate;trimethyl(phenyl)azanium is sourced from PubChem (CID 126506580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).