About trimethyl(phenyl)azanium permanganate
trimethyl(phenyl)azanium permanganate (PubChem CID 134811481) has the molecular formula C9H14MnNO4
and a molecular weight of 255.15 g/mol. Its IUPAC name is trimethyl(phenyl)azanium permanganate.
Molecular Properties
| Compound Name | trimethyl(phenyl)azanium permanganate |
| PubChem CID | 134811481 |
| Molecular Formula | C9H14MnNO4 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | trimethyl(phenyl)azanium permanganate |
| SMILES | C[N+](C)(C)c1ccccc1.O=[Mn](=O)(=O)[O-] |
| InChI | InChI=1S/C9H14N.Mn.4O/c1-10(2,3)9-7-5-4-6-8-9;;;;;/h4-8H,1-3H3;;;;;/q+1;;;;;-1 |
| InChIKey | BFCLATSLZFVDHH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(phenyl)azanium permanganate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(phenyl)azanium permanganate?
The IUPAC name of trimethyl(phenyl)azanium permanganate (CID 134811481) is trimethyl(phenyl)azanium permanganate.
What is the SMILES notation for trimethyl(phenyl)azanium permanganate?
The canonical SMILES for trimethyl(phenyl)azanium permanganate is C[N+](C)(C)c1ccccc1.O=[Mn](=O)(=O)[O-].
What is the InChIKey of trimethyl(phenyl)azanium permanganate?
The InChIKey is BFCLATSLZFVDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N.Mn.4O/c1-10(2,3)9-7-5-4-6-8-9;;;;;/h4-8H,1-3H3;;;;;/q+1;;;;;-1.
What are the key properties of trimethyl(phenyl)azanium permanganate?
trimethyl(phenyl)azanium permanganate has a molecular weight of 255.15 g/mol, XLogP of 0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(phenyl)azanium permanganate is sourced from PubChem (CID 134811481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).