About fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium)
fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) (PubChem CID 66672523) has the molecular formula C18H28BFN2O2
and a molecular weight of 334.24 g/mol. Its IUPAC name is fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium).
Molecular Properties
| Compound Name | fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) |
| PubChem CID | 66672523 |
| Molecular Formula | C18H28BFN2O2 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) |
| SMILES | C[N+](C)(C)c1ccccc1.C[N+](C)(C)c1ccccc1.[O-]B([O-])F |
| InChI | InChI=1S/2C9H14N.BFO2/c2*1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h2*4-8H,1-3H3;/q2*+1;-2 |
| InChIKey | QCTDCPYBZQIJNC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium)?
The IUPAC name of fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) (CID 66672523) is fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium).
What is the SMILES notation for fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium)?
The canonical SMILES for fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) is C[N+](C)(C)c1ccccc1.C[N+](C)(C)c1ccccc1.[O-]B([O-])F.
What is the InChIKey of fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium)?
The InChIKey is QCTDCPYBZQIJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H14N.BFO2/c2*1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h2*4-8H,1-3H3;/q2*+1;-2.
What are the key properties of fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium)?
fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) has a molecular weight of 334.24 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(dioxido)borane;bis(trimethyl(phenyl)azanium) is sourced from PubChem (CID 66672523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).