About chloroalumane;trimethyl(phenyl)azanium;chloride
chloroalumane;trimethyl(phenyl)azanium;chloride (PubChem CID 173074857) has the molecular formula C9H16AlCl2N
and a molecular weight of 236.12 g/mol. Its IUPAC name is chloroalumane;trimethyl(phenyl)azanium;chloride.
Molecular Properties
| Compound Name | chloroalumane;trimethyl(phenyl)azanium;chloride |
| PubChem CID | 173074857 |
| Molecular Formula | C9H16AlCl2N |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | chloroalumane;trimethyl(phenyl)azanium;chloride |
| SMILES | C[N+](C)(C)c1ccccc1.[AlH2]Cl.[Cl-] |
| InChI | InChI=1S/C9H14N.Al.2ClH.2H/c1-10(2,3)9-7-5-4-6-8-9;;;;;/h4-8H,1-3H3;;2*1H;;/q2*+1;;;;/p-2 |
| InChIKey | VUNDPYUQZXOPJR-UHFFFAOYSA-L |
| XLogP | -1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze chloroalumane;trimethyl(phenyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroalumane;trimethyl(phenyl)azanium;chloride?
The IUPAC name of chloroalumane;trimethyl(phenyl)azanium;chloride (CID 173074857) is chloroalumane;trimethyl(phenyl)azanium;chloride.
What is the SMILES notation for chloroalumane;trimethyl(phenyl)azanium;chloride?
The canonical SMILES for chloroalumane;trimethyl(phenyl)azanium;chloride is C[N+](C)(C)c1ccccc1.[AlH2]Cl.[Cl-].
What is the InChIKey of chloroalumane;trimethyl(phenyl)azanium;chloride?
The InChIKey is VUNDPYUQZXOPJR-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H14N.Al.2ClH.2H/c1-10(2,3)9-7-5-4-6-8-9;;;;;/h4-8H,1-3H3;;2*1H;;/q2*+1;;;;/p-2.
What are the key properties of chloroalumane;trimethyl(phenyl)azanium;chloride?
chloroalumane;trimethyl(phenyl)azanium;chloride has a molecular weight of 236.12 g/mol, XLogP of -1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroalumane;trimethyl(phenyl)azanium;chloride is sourced from PubChem (CID 173074857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).