About oxalate;bis(trimethyl(phenyl)azanium)
oxalate;bis(trimethyl(phenyl)azanium) (PubChem CID 66900184) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is oxalate;bis(trimethyl(phenyl)azanium).
Molecular Properties
| Compound Name | oxalate;bis(trimethyl(phenyl)azanium) |
| PubChem CID | 66900184 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | oxalate;bis(trimethyl(phenyl)azanium) |
| SMILES | C[N+](C)(C)c1ccccc1.C[N+](C)(C)c1ccccc1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C9H14N.C2H2O4/c2*1-10(2,3)9-7-5-4-6-8-9;3-1(4)2(5)6/h2*4-8H,1-3H3;(H,3,4)(H,5,6)/q2*+1;/p-2 |
| InChIKey | FHEMCWQRFAJAAK-UHFFFAOYSA-L |
| XLogP | 0.25 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxalate;bis(trimethyl(phenyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalate;bis(trimethyl(phenyl)azanium)?
The IUPAC name of oxalate;bis(trimethyl(phenyl)azanium) (CID 66900184) is oxalate;bis(trimethyl(phenyl)azanium).
What is the SMILES notation for oxalate;bis(trimethyl(phenyl)azanium)?
The canonical SMILES for oxalate;bis(trimethyl(phenyl)azanium) is C[N+](C)(C)c1ccccc1.C[N+](C)(C)c1ccccc1.O=C([O-])C(=O)[O-].
What is the InChIKey of oxalate;bis(trimethyl(phenyl)azanium)?
The InChIKey is FHEMCWQRFAJAAK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H14N.C2H2O4/c2*1-10(2,3)9-7-5-4-6-8-9;3-1(4)2(5)6/h2*4-8H,1-3H3;(H,3,4)(H,5,6)/q2*+1;/p-2.
What are the key properties of oxalate;bis(trimethyl(phenyl)azanium)?
oxalate;bis(trimethyl(phenyl)azanium) has a molecular weight of 360.45 g/mol, XLogP of 0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalate;bis(trimethyl(phenyl)azanium) is sourced from PubChem (CID 66900184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).