C27H42N2O4 — CID 67933339
2-(3-methylpentan-3-yl)propanedioate;bis(trimethyl(phenyl)azanium) (PubChem CID 67933339) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-(3-methylpentan-3-yl)propanedioate;bis(trimethyl(phenyl)azanium).
| Compound Name | 2-(3-methylpentan-3-yl)propanedioate;bis(trimethyl(phenyl)azanium) |
|---|---|
| PubChem CID | 67933339 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 2-(3-methylpentan-3-yl)propanedioate;bis(trimethyl(phenyl)azanium) |
| SMILES | CCC(C)(CC)C(C(=O)[O-])C(=O)[O-].C[N+](C)(C)c1ccccc1.C[N+](C)(C)c1ccccc1 |
| InChI | InChI=1S/2C9H14N.C9H16O4/c2*1-10(2,3)9-7-5-4-6-8-9;1-4-9(3,5-2)6(7(10)11)8(12)13/h2*4-8H,1-3H3;6H,4-5H2,1-3H3,(H,10,11)(H,12,13)/q2*+1;/p-2 |
| InChIKey | VGIKYBCZFMUHAV-UHFFFAOYSA-L |
| XLogP | 2.70 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|