About benzyl(trimethyl)azanium;propanoate
benzyl(trimethyl)azanium;propanoate (PubChem CID 87903949) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;propanoate.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;propanoate |
| PubChem CID | 87903949 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | benzyl(trimethyl)azanium;propanoate |
| SMILES | CCC(=O)[O-].C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.C3H6O2/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3(4)5/h4-8H,9H2,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | CIJYJXGJDFCUFV-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;propanoate?
The IUPAC name of benzyl(trimethyl)azanium;propanoate (CID 87903949) is benzyl(trimethyl)azanium;propanoate.
What is the SMILES notation for benzyl(trimethyl)azanium;propanoate?
The canonical SMILES for benzyl(trimethyl)azanium;propanoate is CCC(=O)[O-].C[N+](C)(C)Cc1ccccc1.
What is the InChIKey of benzyl(trimethyl)azanium;propanoate?
The InChIKey is CIJYJXGJDFCUFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N.C3H6O2/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3(4)5/h4-8H,9H2,1-3H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of benzyl(trimethyl)azanium;propanoate?
benzyl(trimethyl)azanium;propanoate has a molecular weight of 223.32 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;propanoate is sourced from PubChem (CID 87903949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).