About benzyl(trimethyl)azanium;hydroxymethanolate
benzyl(trimethyl)azanium;hydroxymethanolate (PubChem CID 87247218) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;hydroxymethanolate.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;hydroxymethanolate |
| PubChem CID | 87247218 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | benzyl(trimethyl)azanium;hydroxymethanolate |
| SMILES | C[N+](C)(C)Cc1ccccc1.[O-]CO |
| InChI | InChI=1S/C10H16N.CH3O2/c1-11(2,3)9-10-7-5-4-6-8-10;2-1-3/h4-8H,9H2,1-3H3;2H,1H2/q+1;-1 |
| InChIKey | VSBPJNQPVSBCKX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;hydroxymethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;hydroxymethanolate?
The IUPAC name of benzyl(trimethyl)azanium;hydroxymethanolate (CID 87247218) is benzyl(trimethyl)azanium;hydroxymethanolate.
What is the SMILES notation for benzyl(trimethyl)azanium;hydroxymethanolate?
The canonical SMILES for benzyl(trimethyl)azanium;hydroxymethanolate is C[N+](C)(C)Cc1ccccc1.[O-]CO.
What is the InChIKey of benzyl(trimethyl)azanium;hydroxymethanolate?
The InChIKey is VSBPJNQPVSBCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N.CH3O2/c1-11(2,3)9-10-7-5-4-6-8-10;2-1-3/h4-8H,9H2,1-3H3;2H,1H2/q+1;-1.
What are the key properties of benzyl(trimethyl)azanium;hydroxymethanolate?
benzyl(trimethyl)azanium;hydroxymethanolate has a molecular weight of 197.28 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;hydroxymethanolate is sourced from PubChem (CID 87247218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).