C18H21NO4 — CID 160859631
benzyl(trimethyl)azanium;2-carboxybenzoate (PubChem CID 160859631) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;2-carboxybenzoate.
| Compound Name | benzyl(trimethyl)azanium;2-carboxybenzoate |
|---|---|
| PubChem CID | 160859631 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | benzyl(trimethyl)azanium;2-carboxybenzoate |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=C([O-])c1ccccc1C(=O)O |
| InChI | InChI=1S/C10H16N.C8H6O4/c1-11(2,3)9-10-7-5-4-6-8-10;9-7(10)5-3-1-2-4-6(5)8(11)12/h4-8H,9H2,1-3H3;1-4H,(H,9,10)(H,11,12)/q+1;/p-1 |
| InChIKey | SKHSAPMJLWLXEP-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|