C24H25NO6S — CID 18948068
benzyl(trimethyl)azanium;2-(2-carboxyphenyl)sulfonylbenzoate (PubChem CID 18948068) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;2-(2-carboxyphenyl)sulfonylbenzoate.
| Compound Name | benzyl(trimethyl)azanium;2-(2-carboxyphenyl)sulfonylbenzoate |
|---|---|
| PubChem CID | 18948068 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | benzyl(trimethyl)azanium;2-(2-carboxyphenyl)sulfonylbenzoate |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=C([O-])c1ccccc1S(=O)(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10O6S.C10H16N/c15-13(16)9-5-1-3-7-11(9)21(19,20)12-8-4-2-6-10(12)14(17)18;1-11(2,3)9-10-7-5-4-6-8-10/h1-8H,(H,15,16)(H,17,18);4-8H,9H2,1-3H3/q;+1/p-1 |
| InChIKey | IGZNHXGQHMLPIB-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|