C14H21NO2 — CID 172775638
benzyl(trimethyl)azanium;but-2-enoate (PubChem CID 172775638) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;but-2-enoate.
| Compound Name | benzyl(trimethyl)azanium;but-2-enoate |
|---|---|
| PubChem CID | 172775638 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | benzyl(trimethyl)azanium;but-2-enoate |
| SMILES | CC=CC(=O)[O-].C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.C4H6O2/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3-4(5)6/h4-8H,9H2,1-3H3;2-3H,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | NOCCSEPEPICCGU-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|