C50H54N2O4 — CID 175591945
(E)-but-2-enedioate;bis(dibenzyl-methyl-(2-phenylethyl)azanium) (PubChem CID 175591945) has the molecular formula C50H54N2O4 and a molecular weight of 746.99 g/mol. Its IUPAC name is (E)-but-2-enedioate;bis(dibenzyl-methyl-(2-phenylethyl)azanium).
| Compound Name | (E)-but-2-enedioate;bis(dibenzyl-methyl-(2-phenylethyl)azanium) |
|---|---|
| PubChem CID | 175591945 |
| Molecular Formula | C50H54N2O4 |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.41 |
| IUPAC Name | (E)-but-2-enedioate;bis(dibenzyl-methyl-(2-phenylethyl)azanium) |
| SMILES | C[N+](CCc1ccccc1)(Cc1ccccc1)Cc1ccccc1.C[N+](CCc1ccccc1)(Cc1ccccc1)Cc1ccccc1.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/2C23H26N.C4H4O4/c2*1-24(19-22-13-7-3-8-14-22,20-23-15-9-4-10-16-23)18-17-21-11-5-2-6-12-21;5-3(6)1-2-4(7)8/h2*2-16H,17-20H2,1H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1+ |
| InChIKey | IFJCPVDSXVJVQZ-WXXKFALUSA-L |
| XLogP | 7.19 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|