About benzyl(triethyl)azanium;hydrogen carbonate
benzyl(triethyl)azanium;hydrogen carbonate (PubChem CID 29687) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is benzyl(triethyl)azanium;hydrogen carbonate.
Molecular Properties
| Compound Name | benzyl(triethyl)azanium;hydrogen carbonate |
| PubChem CID | 29687 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | benzyl(triethyl)azanium;hydrogen carbonate |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.O=C([O-])O |
| InChI | InChI=1S/C13H22N.CH2O3/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;2-1(3)4/h7-11H,4-6,12H2,1-3H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | VIJKGBZMANAGQI-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethyl)azanium;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethyl)azanium;hydrogen carbonate?
The IUPAC name of benzyl(triethyl)azanium;hydrogen carbonate (CID 29687) is benzyl(triethyl)azanium;hydrogen carbonate.
What is the SMILES notation for benzyl(triethyl)azanium;hydrogen carbonate?
The canonical SMILES for benzyl(triethyl)azanium;hydrogen carbonate is CC[N+](CC)(CC)Cc1ccccc1.O=C([O-])O.
What is the InChIKey of benzyl(triethyl)azanium;hydrogen carbonate?
The InChIKey is VIJKGBZMANAGQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H22N.CH2O3/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;2-1(3)4/h7-11H,4-6,12H2,1-3H3;(H2,2,3,4)/q+1;/p-1.
What are the key properties of benzyl(triethyl)azanium;hydrogen carbonate?
benzyl(triethyl)azanium;hydrogen carbonate has a molecular weight of 253.34 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethyl)azanium;hydrogen carbonate is sourced from PubChem (CID 29687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).