About benzyl(triethyl)azanium;trimethyl(phenyl)azanium
benzyl(triethyl)azanium;trimethyl(phenyl)azanium (PubChem CID 158940719) has the molecular formula C22H36N2+2
and a molecular weight of 328.54 g/mol. Its IUPAC name is benzyl(triethyl)azanium;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | benzyl(triethyl)azanium;trimethyl(phenyl)azanium |
| PubChem CID | 158940719 |
| Molecular Formula | C22H36N2+2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | benzyl(triethyl)azanium;trimethyl(phenyl)azanium |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.C[N+](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H22N.C9H14N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;1-10(2,3)9-7-5-4-6-8-9/h7-11H,4-6,12H2,1-3H3;4-8H,1-3H3/q2*+1 |
| InChIKey | JKFBPMMCWHAJHS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethyl)azanium;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethyl)azanium;trimethyl(phenyl)azanium?
The IUPAC name of benzyl(triethyl)azanium;trimethyl(phenyl)azanium (CID 158940719) is benzyl(triethyl)azanium;trimethyl(phenyl)azanium.
What is the SMILES notation for benzyl(triethyl)azanium;trimethyl(phenyl)azanium?
The canonical SMILES for benzyl(triethyl)azanium;trimethyl(phenyl)azanium is CC[N+](CC)(CC)Cc1ccccc1.C[N+](C)(C)c1ccccc1.
What is the InChIKey of benzyl(triethyl)azanium;trimethyl(phenyl)azanium?
The InChIKey is JKFBPMMCWHAJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N.C9H14N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;1-10(2,3)9-7-5-4-6-8-9/h7-11H,4-6,12H2,1-3H3;4-8H,1-3H3/q2*+1.
What are the key properties of benzyl(triethyl)azanium;trimethyl(phenyl)azanium?
benzyl(triethyl)azanium;trimethyl(phenyl)azanium has a molecular weight of 328.54 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethyl)azanium;trimethyl(phenyl)azanium is sourced from PubChem (CID 158940719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).