About azane;benzyl(triethyl)azanium;hydrofluoride
azane;benzyl(triethyl)azanium;hydrofluoride (PubChem CID 174537374) has the molecular formula C13H26FN2+
and a molecular weight of 229.36 g/mol. Its IUPAC name is azane;benzyl(triethyl)azanium;hydrofluoride.
Molecular Properties
| Compound Name | azane;benzyl(triethyl)azanium;hydrofluoride |
| PubChem CID | 174537374 |
| Molecular Formula | C13H26FN2+ |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.21 |
| IUPAC Name | azane;benzyl(triethyl)azanium;hydrofluoride |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.F.N |
| InChI | InChI=1S/C13H22N.FH.H3N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;;/h7-11H,4-6,12H2,1-3H3;1H;1H3/q+1;; |
| InChIKey | BWYCMSBQPHMFPR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze azane;benzyl(triethyl)azanium;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzyl(triethyl)azanium;hydrofluoride?
The IUPAC name of azane;benzyl(triethyl)azanium;hydrofluoride (CID 174537374) is azane;benzyl(triethyl)azanium;hydrofluoride.
What is the SMILES notation for azane;benzyl(triethyl)azanium;hydrofluoride?
The canonical SMILES for azane;benzyl(triethyl)azanium;hydrofluoride is CC[N+](CC)(CC)Cc1ccccc1.F.N.
What is the InChIKey of azane;benzyl(triethyl)azanium;hydrofluoride?
The InChIKey is BWYCMSBQPHMFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N.FH.H3N/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;;/h7-11H,4-6,12H2,1-3H3;1H;1H3/q+1;;.
What are the key properties of azane;benzyl(triethyl)azanium;hydrofluoride?
azane;benzyl(triethyl)azanium;hydrofluoride has a molecular weight of 229.36 g/mol, XLogP of 3.38, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzyl(triethyl)azanium;hydrofluoride is sourced from PubChem (CID 174537374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).