C34H48N2O4 — CID 21225187
bis(benzyl(triethyl)azanium);terephthalate (PubChem CID 21225187) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is bis(benzyl(triethyl)azanium);terephthalate.
| Compound Name | bis(benzyl(triethyl)azanium);terephthalate |
|---|---|
| PubChem CID | 21225187 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | bis(benzyl(triethyl)azanium);terephthalate |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.CC[N+](CC)(CC)Cc1ccccc1.O=C([O-])c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/2C13H22N.C8H6O4/c2*1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*7-11H,4-6,12H2,1-3H3;1-4H,(H,9,10)(H,11,12)/q2*+1;/p-2 |
| InChIKey | XNIDLLHHXDLVNW-UHFFFAOYSA-L |
| XLogP | 4.54 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|