C16H27BrN2O — CID 88664409
benzyl(triethyl)azanium;prop-2-enamide;bromide (PubChem CID 88664409) has the molecular formula C16H27BrN2O and a molecular weight of 343.31 g/mol. Its IUPAC name is benzyl(triethyl)azanium;prop-2-enamide;bromide.
| Compound Name | benzyl(triethyl)azanium;prop-2-enamide;bromide |
|---|---|
| PubChem CID | 88664409 |
| Molecular Formula | C16H27BrN2O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | benzyl(triethyl)azanium;prop-2-enamide;bromide |
| SMILES | C=CC(N)=O.CC[N+](CC)(CC)Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C13H22N.C3H5NO.BrH/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;1-2-3(4)5;/h7-11H,4-6,12H2,1-3H3;2H,1H2,(H2,4,5);1H/q+1;;/p-1 |
| InChIKey | PIZFCIFGERUVBD-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|