About prop-2-enamide;tetraethylazanium
prop-2-enamide;tetraethylazanium (PubChem CID 160757497) has the molecular formula C11H25N2O+
and a molecular weight of 201.33 g/mol. Its IUPAC name is prop-2-enamide;tetraethylazanium.
Molecular Properties
| Compound Name | prop-2-enamide;tetraethylazanium |
| PubChem CID | 160757497 |
| Molecular Formula | C11H25N2O+ |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.20 |
| IUPAC Name | prop-2-enamide;tetraethylazanium |
| SMILES | C=CC(N)=O.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C3H5NO/c1-5-9(6-2,7-3)8-4;1-2-3(4)5/h5-8H2,1-4H3;2H,1H2,(H2,4,5)/q+1; |
| InChIKey | RXPWTTYSYATPQI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enamide;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enamide;tetraethylazanium?
The IUPAC name of prop-2-enamide;tetraethylazanium (CID 160757497) is prop-2-enamide;tetraethylazanium.
What is the SMILES notation for prop-2-enamide;tetraethylazanium?
The canonical SMILES for prop-2-enamide;tetraethylazanium is C=CC(N)=O.CC[N+](CC)(CC)CC.
What is the InChIKey of prop-2-enamide;tetraethylazanium?
The InChIKey is RXPWTTYSYATPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C3H5NO/c1-5-9(6-2,7-3)8-4;1-2-3(4)5/h5-8H2,1-4H3;2H,1H2,(H2,4,5)/q+1;.
What are the key properties of prop-2-enamide;tetraethylazanium?
prop-2-enamide;tetraethylazanium has a molecular weight of 201.33 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enamide;tetraethylazanium is sourced from PubChem (CID 160757497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).