About carbamic acid;tetraethylazanium
carbamic acid;tetraethylazanium (PubChem CID 159284464) has the molecular formula C9H23N2O2+
and a molecular weight of 191.29 g/mol. Its IUPAC name is carbamic acid;tetraethylazanium.
Molecular Properties
| Compound Name | carbamic acid;tetraethylazanium |
| PubChem CID | 159284464 |
| Molecular Formula | C9H23N2O2+ |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.18 |
| IUPAC Name | carbamic acid;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.NC(=O)O |
| InChI | InChI=1S/C8H20N.CH3NO2/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;2H2,(H,3,4)/q+1; |
| InChIKey | KZIHJWBQQBFFKR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;tetraethylazanium?
The IUPAC name of carbamic acid;tetraethylazanium (CID 159284464) is carbamic acid;tetraethylazanium.
What is the SMILES notation for carbamic acid;tetraethylazanium?
The canonical SMILES for carbamic acid;tetraethylazanium is CC[N+](CC)(CC)CC.NC(=O)O.
What is the InChIKey of carbamic acid;tetraethylazanium?
The InChIKey is KZIHJWBQQBFFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.CH3NO2/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;2H2,(H,3,4)/q+1;.
What are the key properties of carbamic acid;tetraethylazanium?
carbamic acid;tetraethylazanium has a molecular weight of 191.29 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;tetraethylazanium is sourced from PubChem (CID 159284464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).