About tetraethylazanium;urea;hydroxide
tetraethylazanium;urea;hydroxide (PubChem CID 175541942) has the molecular formula C9H25N3O2
and a molecular weight of 207.32 g/mol. Its IUPAC name is tetraethylazanium;urea;hydroxide.
Molecular Properties
| Compound Name | tetraethylazanium;urea;hydroxide |
| PubChem CID | 175541942 |
| Molecular Formula | C9H25N3O2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | tetraethylazanium;urea;hydroxide |
| SMILES | CC[N+](CC)(CC)CC.NC(N)=O.[OH-] |
| InChI | InChI=1S/C8H20N.CH4N2O.H2O/c1-5-9(6-2,7-3)8-4;2-1(3)4;/h5-8H2,1-4H3;(H4,2,3,4);1H2/q+1;;/p-1 |
| InChIKey | XVMPMAUIVXUKKR-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraethylazanium;urea;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraethylazanium;urea;hydroxide?
The IUPAC name of tetraethylazanium;urea;hydroxide (CID 175541942) is tetraethylazanium;urea;hydroxide.
What is the SMILES notation for tetraethylazanium;urea;hydroxide?
The canonical SMILES for tetraethylazanium;urea;hydroxide is CC[N+](CC)(CC)CC.NC(N)=O.[OH-].
What is the InChIKey of tetraethylazanium;urea;hydroxide?
The InChIKey is XVMPMAUIVXUKKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.CH4N2O.H2O/c1-5-9(6-2,7-3)8-4;2-1(3)4;/h5-8H2,1-4H3;(H4,2,3,4);1H2/q+1;;/p-1.
What are the key properties of tetraethylazanium;urea;hydroxide?
tetraethylazanium;urea;hydroxide has a molecular weight of 207.32 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetraethylazanium;urea;hydroxide is sourced from PubChem (CID 175541942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).