About dihydroxy(oxo)phosphanium;tetraethylazanium
dihydroxy(oxo)phosphanium;tetraethylazanium (PubChem CID 175533770) has the molecular formula C8H22NO3P+2
and a molecular weight of 211.24 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;tetraethylazanium.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;tetraethylazanium |
| PubChem CID | 175533770 |
| Molecular Formula | C8H22NO3P+2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | dihydroxy(oxo)phosphanium;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=[P+](O)O |
| InChI | InChI=1S/C8H20N.HO3P/c1-5-9(6-2,7-3)8-4;1-4(2)3/h5-8H2,1-4H3;(H-,1,2,3)/q+1;/p+1 |
| InChIKey | QIBLESXIKNBFJB-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;tetraethylazanium?
The IUPAC name of dihydroxy(oxo)phosphanium;tetraethylazanium (CID 175533770) is dihydroxy(oxo)phosphanium;tetraethylazanium.
What is the SMILES notation for dihydroxy(oxo)phosphanium;tetraethylazanium?
The canonical SMILES for dihydroxy(oxo)phosphanium;tetraethylazanium is CC[N+](CC)(CC)CC.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;tetraethylazanium?
The InChIKey is QIBLESXIKNBFJB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H20N.HO3P/c1-5-9(6-2,7-3)8-4;1-4(2)3/h5-8H2,1-4H3;(H-,1,2,3)/q+1;/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;tetraethylazanium?
dihydroxy(oxo)phosphanium;tetraethylazanium has a molecular weight of 211.24 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;tetraethylazanium is sourced from PubChem (CID 175533770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).