About oxalic acid;tetraethylazanium
oxalic acid;tetraethylazanium (PubChem CID 24888116) has the molecular formula C10H22NO4+
and a molecular weight of 220.29 g/mol. Its IUPAC name is oxalic acid;tetraethylazanium.
Molecular Properties
| Compound Name | oxalic acid;tetraethylazanium |
| PubChem CID | 24888116 |
| Molecular Formula | C10H22NO4+ |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | oxalic acid;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H20N.C2H2O4/c1-5-9(6-2,7-3)8-4;3-1(4)2(5)6/h5-8H2,1-4H3;(H,3,4)(H,5,6)/q+1; |
| InChIKey | POQQCFGEBOXGIT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;tetraethylazanium?
The IUPAC name of oxalic acid;tetraethylazanium (CID 24888116) is oxalic acid;tetraethylazanium.
What is the SMILES notation for oxalic acid;tetraethylazanium?
The canonical SMILES for oxalic acid;tetraethylazanium is CC[N+](CC)(CC)CC.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;tetraethylazanium?
The InChIKey is POQQCFGEBOXGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C2H2O4/c1-5-9(6-2,7-3)8-4;3-1(4)2(5)6/h5-8H2,1-4H3;(H,3,4)(H,5,6)/q+1;.
What are the key properties of oxalic acid;tetraethylazanium?
oxalic acid;tetraethylazanium has a molecular weight of 220.29 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;tetraethylazanium is sourced from PubChem (CID 24888116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).