About methanol;tetraethylazanium;hydroxide
methanol;tetraethylazanium;hydroxide (PubChem CID 159654840) has the molecular formula C9H25NO2
and a molecular weight of 179.30 g/mol. Its IUPAC name is methanol;tetraethylazanium;hydroxide.
Molecular Properties
| Compound Name | methanol;tetraethylazanium;hydroxide |
| PubChem CID | 159654840 |
| Molecular Formula | C9H25NO2 |
| Molecular Weight | 179.30 g/mol |
| Exact Mass | 179.19 |
| IUPAC Name | methanol;tetraethylazanium;hydroxide |
| SMILES | CC[N+](CC)(CC)CC.CO.[OH-] |
| InChI | InChI=1S/C8H20N.CH4O.H2O/c1-5-9(6-2,7-3)8-4;1-2;/h5-8H2,1-4H3;2H,1H3;1H2/q+1;;/p-1 |
| InChIKey | MSAQXBWFCRKTLJ-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 50.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methanol;tetraethylazanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;tetraethylazanium;hydroxide?
The IUPAC name of methanol;tetraethylazanium;hydroxide (CID 159654840) is methanol;tetraethylazanium;hydroxide.
What is the SMILES notation for methanol;tetraethylazanium;hydroxide?
The canonical SMILES for methanol;tetraethylazanium;hydroxide is CC[N+](CC)(CC)CC.CO.[OH-].
What is the InChIKey of methanol;tetraethylazanium;hydroxide?
The InChIKey is MSAQXBWFCRKTLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.CH4O.H2O/c1-5-9(6-2,7-3)8-4;1-2;/h5-8H2,1-4H3;2H,1H3;1H2/q+1;;/p-1.
What are the key properties of methanol;tetraethylazanium;hydroxide?
methanol;tetraethylazanium;hydroxide has a molecular weight of 179.30 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;tetraethylazanium;hydroxide is sourced from PubChem (CID 159654840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).