About prop-2-enamide iodide
prop-2-enamide iodide (PubChem CID 19796963) has the molecular formula C3H5INO-
and a molecular weight of 197.98 g/mol. Its IUPAC name is prop-2-enamide iodide.
Molecular Properties
| Compound Name | prop-2-enamide iodide |
| PubChem CID | 19796963 |
| Molecular Formula | C3H5INO- |
| Molecular Weight | 197.98 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | prop-2-enamide iodide |
| SMILES | C=CC(N)=O.[I-] |
| InChI | InChI=1S/C3H5NO.HI/c1-2-3(4)5;/h2H,1H2,(H2,4,5);1H/p-1 |
| InChIKey | ASMMZFOAVNBGFH-UHFFFAOYSA-M |
| XLogP | -3.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.98 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enamide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enamide iodide?
The IUPAC name of prop-2-enamide iodide (CID 19796963) is prop-2-enamide iodide.
What is the SMILES notation for prop-2-enamide iodide?
The canonical SMILES for prop-2-enamide iodide is C=CC(N)=O.[I-].
What is the InChIKey of prop-2-enamide iodide?
The InChIKey is ASMMZFOAVNBGFH-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO.HI/c1-2-3(4)5;/h2H,1H2,(H2,4,5);1H/p-1.
What are the key properties of prop-2-enamide iodide?
prop-2-enamide iodide has a molecular weight of 197.98 g/mol, XLogP of -3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enamide iodide is sourced from PubChem (CID 19796963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).