About phosphoric acid;bis(prop-2-enamide)
phosphoric acid;bis(prop-2-enamide) (PubChem CID 175358091) has the molecular formula C6H13N2O6P
and a molecular weight of 240.15 g/mol. Its IUPAC name is phosphoric acid;bis(prop-2-enamide).
Molecular Properties
| Compound Name | phosphoric acid;bis(prop-2-enamide) |
| PubChem CID | 175358091 |
| Molecular Formula | C6H13N2O6P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | phosphoric acid;bis(prop-2-enamide) |
| SMILES | C=CC(N)=O.C=CC(N)=O.O=P(O)(O)O |
| InChI | InChI=1S/2C3H5NO.H3O4P/c2*1-2-3(4)5;1-5(2,3)4/h2*2H,1H2,(H2,4,5);(H3,1,2,3,4) |
| InChIKey | CLPQAHVQPHTNBS-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;bis(prop-2-enamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;bis(prop-2-enamide)?
The IUPAC name of phosphoric acid;bis(prop-2-enamide) (CID 175358091) is phosphoric acid;bis(prop-2-enamide).
What is the SMILES notation for phosphoric acid;bis(prop-2-enamide)?
The canonical SMILES for phosphoric acid;bis(prop-2-enamide) is C=CC(N)=O.C=CC(N)=O.O=P(O)(O)O.
What is the InChIKey of phosphoric acid;bis(prop-2-enamide)?
The InChIKey is CLPQAHVQPHTNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H5NO.H3O4P/c2*1-2-3(4)5;1-5(2,3)4/h2*2H,1H2,(H2,4,5);(H3,1,2,3,4).
What are the key properties of phosphoric acid;bis(prop-2-enamide)?
phosphoric acid;bis(prop-2-enamide) has a molecular weight of 240.15 g/mol, XLogP of -1.61, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;bis(prop-2-enamide) is sourced from PubChem (CID 175358091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).