About magnesium;prop-2-enamide;dihydroxide
magnesium;prop-2-enamide;dihydroxide (PubChem CID 175298952) has the molecular formula C3H7MgNO3
and a molecular weight of 129.40 g/mol. Its IUPAC name is magnesium;prop-2-enamide;dihydroxide.
Molecular Properties
| Compound Name | magnesium;prop-2-enamide;dihydroxide |
| PubChem CID | 175298952 |
| Molecular Formula | C3H7MgNO3 |
| Molecular Weight | 129.40 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | magnesium;prop-2-enamide;dihydroxide |
| SMILES | C=CC(N)=O.[Mg+2].[OH-].[OH-] |
| InChI | InChI=1S/C3H5NO.Mg.2H2O/c1-2-3(4)5;;;/h2H,1H2,(H2,4,5);;2*1H2/q;+2;;/p-2 |
| InChIKey | IXBJDJCKOUPDKQ-UHFFFAOYSA-L |
| XLogP | -1.08 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.40 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;prop-2-enamide;dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;prop-2-enamide;dihydroxide?
The IUPAC name of magnesium;prop-2-enamide;dihydroxide (CID 175298952) is magnesium;prop-2-enamide;dihydroxide.
What is the SMILES notation for magnesium;prop-2-enamide;dihydroxide?
The canonical SMILES for magnesium;prop-2-enamide;dihydroxide is C=CC(N)=O.[Mg+2].[OH-].[OH-].
What is the InChIKey of magnesium;prop-2-enamide;dihydroxide?
The InChIKey is IXBJDJCKOUPDKQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H5NO.Mg.2H2O/c1-2-3(4)5;;;/h2H,1H2,(H2,4,5);;2*1H2/q;+2;;/p-2.
What are the key properties of magnesium;prop-2-enamide;dihydroxide?
magnesium;prop-2-enamide;dihydroxide has a molecular weight of 129.40 g/mol, XLogP of -1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;prop-2-enamide;dihydroxide is sourced from PubChem (CID 175298952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).