About methanamine;prop-2-enamide;hydrate
methanamine;prop-2-enamide;hydrate (PubChem CID 174696935) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is methanamine;prop-2-enamide;hydrate.
Molecular Properties
| Compound Name | methanamine;prop-2-enamide;hydrate |
| PubChem CID | 174696935 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | methanamine;prop-2-enamide;hydrate |
| SMILES | C=CC(N)=O.CN.O |
| InChI | InChI=1S/C3H5NO.CH5N.H2O/c1-2-3(4)5;1-2;/h2H,1H2,(H2,4,5);2H2,1H3;1H2 |
| InChIKey | LYFWSNRUHXQJKQ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanamine;prop-2-enamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;prop-2-enamide;hydrate?
The IUPAC name of methanamine;prop-2-enamide;hydrate (CID 174696935) is methanamine;prop-2-enamide;hydrate.
What is the SMILES notation for methanamine;prop-2-enamide;hydrate?
The canonical SMILES for methanamine;prop-2-enamide;hydrate is C=CC(N)=O.CN.O.
What is the InChIKey of methanamine;prop-2-enamide;hydrate?
The InChIKey is LYFWSNRUHXQJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.CH5N.H2O/c1-2-3(4)5;1-2;/h2H,1H2,(H2,4,5);2H2,1H3;1H2.
What are the key properties of methanamine;prop-2-enamide;hydrate?
methanamine;prop-2-enamide;hydrate has a molecular weight of 120.15 g/mol, XLogP of -1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;prop-2-enamide;hydrate is sourced from PubChem (CID 174696935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).