About azanium;prop-2-enamide;acetate
azanium;prop-2-enamide;acetate (PubChem CID 172806462) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is azanium;prop-2-enamide;acetate.
Molecular Properties
| Compound Name | azanium;prop-2-enamide;acetate |
| PubChem CID | 172806462 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | azanium;prop-2-enamide;acetate |
| SMILES | C=CC(N)=O.CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C3H5NO.C2H4O2.H3N/c1-2-3(4)5;1-2(3)4;/h2H,1H2,(H2,4,5);1H3,(H,3,4);1H3 |
| InChIKey | ROSLSRACPNKZCR-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azanium;prop-2-enamide;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;prop-2-enamide;acetate?
The IUPAC name of azanium;prop-2-enamide;acetate (CID 172806462) is azanium;prop-2-enamide;acetate.
What is the SMILES notation for azanium;prop-2-enamide;acetate?
The canonical SMILES for azanium;prop-2-enamide;acetate is C=CC(N)=O.CC(=O)[O-].[NH4+].
What is the InChIKey of azanium;prop-2-enamide;acetate?
The InChIKey is ROSLSRACPNKZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C2H4O2.H3N/c1-2-3(4)5;1-2(3)4;/h2H,1H2,(H2,4,5);1H3,(H,3,4);1H3.
What are the key properties of azanium;prop-2-enamide;acetate?
azanium;prop-2-enamide;acetate has a molecular weight of 148.16 g/mol, XLogP of -1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;prop-2-enamide;acetate is sourced from PubChem (CID 172806462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).