About acetamide;prop-2-enamide
acetamide;prop-2-enamide (PubChem CID 158566181) has the molecular formula C9H20N4O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is acetamide;prop-2-enamide.
Molecular Properties
| Compound Name | acetamide;prop-2-enamide |
| PubChem CID | 158566181 |
| Molecular Formula | C9H20N4O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | acetamide;prop-2-enamide |
| SMILES | C=CC(N)=O.CC(N)=O.CC(N)=O.CC(N)=O |
| InChI | InChI=1S/C3H5NO.3C2H5NO/c1-2-3(4)5;3*1-2(3)4/h2H,1H2,(H2,4,5);3*1H3,(H2,3,4) |
| InChIKey | HRMTZHFHKDXZLO-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze acetamide;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;prop-2-enamide?
The IUPAC name of acetamide;prop-2-enamide (CID 158566181) is acetamide;prop-2-enamide.
What is the SMILES notation for acetamide;prop-2-enamide?
The canonical SMILES for acetamide;prop-2-enamide is C=CC(N)=O.CC(N)=O.CC(N)=O.CC(N)=O.
What is the InChIKey of acetamide;prop-2-enamide?
The InChIKey is HRMTZHFHKDXZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.3C2H5NO/c1-2-3(4)5;3*1-2(3)4/h2H,1H2,(H2,4,5);3*1H3,(H2,3,4).
What are the key properties of acetamide;prop-2-enamide?
acetamide;prop-2-enamide has a molecular weight of 248.28 g/mol, XLogP of -1.87, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;prop-2-enamide is sourced from PubChem (CID 158566181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).