About dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide
dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide (PubChem CID 19070332) has the molecular formula C7H15NO4P+
and a molecular weight of 208.17 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide |
| PubChem CID | 19070332 |
| Molecular Formula | C7H15NO4P+ |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide |
| SMILES | C=C(C)C.C=CC(N)=O.O=[P+](O)O |
| InChI | InChI=1S/C4H8.C3H5NO.HO3P/c1-4(2)3;1-2-3(4)5;1-4(2)3/h1H2,2-3H3;2H,1H2,(H2,4,5);(H-,1,2,3)/p+1 |
| InChIKey | WUSYOKBJBXPNQG-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide?
The IUPAC name of dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide (CID 19070332) is dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide.
What is the SMILES notation for dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide?
The canonical SMILES for dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide is C=C(C)C.C=CC(N)=O.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide?
The InChIKey is WUSYOKBJBXPNQG-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H8.C3H5NO.HO3P/c1-4(2)3;1-2-3(4)5;1-4(2)3/h1H2,2-3H3;2H,1H2,(H2,4,5);(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide?
dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide has a molecular weight of 208.17 g/mol, XLogP of 0.87, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;2-methylprop-1-ene;prop-2-enamide is sourced from PubChem (CID 19070332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).