C5H9NO3 — CID 174658864
ethene-1,1-diol;prop-2-enamide (PubChem CID 174658864) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is ethene-1,1-diol;prop-2-enamide.
| Compound Name | ethene-1,1-diol;prop-2-enamide |
|---|---|
| PubChem CID | 174658864 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | ethene-1,1-diol;prop-2-enamide |
| SMILES | C=C(O)O.C=CC(N)=O |
| InChI | InChI=1S/C3H5NO.C2H4O2/c1-2-3(4)5;1-2(3)4/h2H,1H2,(H2,4,5);3-4H,1H2 |
| InChIKey | HQHMUCOKHAASOH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|