About potassium;prop-2-enamide;chloride
potassium;prop-2-enamide;chloride (PubChem CID 161245795) has the molecular formula C3H5ClKNO
and a molecular weight of 145.63 g/mol. Its IUPAC name is potassium;prop-2-enamide;chloride.
Molecular Properties
| Compound Name | potassium;prop-2-enamide;chloride |
| PubChem CID | 161245795 |
| Molecular Formula | C3H5ClKNO |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 144.97 |
| IUPAC Name | potassium;prop-2-enamide;chloride |
| SMILES | C=CC(N)=O.[Cl-].[K+] |
| InChI | InChI=1S/C3H5NO.ClH.K/c1-2-3(4)5;;/h2H,1H2,(H2,4,5);1H;/q;;+1/p-1 |
| InChIKey | VAPSXCZWELHVGY-UHFFFAOYSA-M |
| XLogP | -6.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;prop-2-enamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;prop-2-enamide;chloride?
The IUPAC name of potassium;prop-2-enamide;chloride (CID 161245795) is potassium;prop-2-enamide;chloride.
What is the SMILES notation for potassium;prop-2-enamide;chloride?
The canonical SMILES for potassium;prop-2-enamide;chloride is C=CC(N)=O.[Cl-].[K+].
What is the InChIKey of potassium;prop-2-enamide;chloride?
The InChIKey is VAPSXCZWELHVGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO.ClH.K/c1-2-3(4)5;;/h2H,1H2,(H2,4,5);1H;/q;;+1/p-1.
What are the key properties of potassium;prop-2-enamide;chloride?
potassium;prop-2-enamide;chloride has a molecular weight of 145.63 g/mol, XLogP of -6.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;prop-2-enamide;chloride is sourced from PubChem (CID 161245795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).