About molecular hydrogen;prop-2-enamide
molecular hydrogen;prop-2-enamide (PubChem CID 156651584) has the molecular formula C3H7NO
and a molecular weight of 73.09 g/mol. Its IUPAC name is molecular hydrogen;prop-2-enamide.
Molecular Properties
| Compound Name | molecular hydrogen;prop-2-enamide |
| PubChem CID | 156651584 |
| Molecular Formula | C3H7NO |
| Molecular Weight | 73.09 g/mol |
| Exact Mass | 73.05 |
| IUPAC Name | molecular hydrogen;prop-2-enamide |
| SMILES | C=CC(N)=O.[H][H] |
| InChI | InChI=1S/C3H5NO.H2/c1-2-3(4)5;/h2H,1H2,(H2,4,5);1H |
| InChIKey | VXFNWZDTNIEWPU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.09 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;prop-2-enamide?
The IUPAC name of molecular hydrogen;prop-2-enamide (CID 156651584) is molecular hydrogen;prop-2-enamide.
What is the SMILES notation for molecular hydrogen;prop-2-enamide?
The canonical SMILES for molecular hydrogen;prop-2-enamide is C=CC(N)=O.[H][H].
What is the InChIKey of molecular hydrogen;prop-2-enamide?
The InChIKey is VXFNWZDTNIEWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.H2/c1-2-3(4)5;/h2H,1H2,(H2,4,5);1H.
What are the key properties of molecular hydrogen;prop-2-enamide?
molecular hydrogen;prop-2-enamide has a molecular weight of 73.09 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;prop-2-enamide is sourced from PubChem (CID 156651584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).