C10H16N2O4 — CID 157463819
2-methylprop-2-enamide;prop-2-enamide;prop-2-enoic acid (PubChem CID 157463819) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-methylprop-2-enamide;prop-2-enamide;prop-2-enoic acid.
| Compound Name | 2-methylprop-2-enamide;prop-2-enamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 157463819 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-methylprop-2-enamide;prop-2-enamide;prop-2-enoic acid |
| SMILES | C=C(C)C(N)=O.C=CC(=O)O.C=CC(N)=O |
| InChI | InChI=1S/C4H7NO.C3H5NO.C3H4O2/c1-3(2)4(5)6;2*1-2-3(4)5/h1H2,2H3,(H2,5,6);2H,1H2,(H2,4,5);2H,1H2,(H,4,5) |
| InChIKey | BUFWFSWJUKBSTP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|