About CID 172708986
CID 172708986 (PubChem CID 172708986) has the molecular formula C6H13NNaO
and a molecular weight of 138.17 g/mol.
Molecular Properties
| Compound Name | CID 172708986 |
| PubChem CID | 172708986 |
| Molecular Formula | C6H13NNaO |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | — |
| SMILES | C=CC(N)=O.CCC.[Na] |
| InChI | InChI=1S/C3H5NO.C3H8.Na/c1-2-3(4)5;1-3-2;/h2H,1H2,(H2,4,5);3H2,1-2H3; |
| InChIKey | DZHKZLJZWFAIFP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 172708986 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172708986?
The IUPAC name of CID 172708986 (CID 172708986) is not available.
What is the SMILES notation for CID 172708986?
The canonical SMILES for CID 172708986 is C=CC(N)=O.CCC.[Na].
What is the InChIKey of CID 172708986?
The InChIKey is DZHKZLJZWFAIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C3H8.Na/c1-2-3(4)5;1-3-2;/h2H,1H2,(H2,4,5);3H2,1-2H3;.
What are the key properties of CID 172708986?
CID 172708986 has a molecular weight of 138.17 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172708986 is sourced from PubChem (CID 172708986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).