About butane;phosphoric acid;prop-2-enamide
butane;phosphoric acid;prop-2-enamide (PubChem CID 159316874) has the molecular formula C7H18NO5P
and a molecular weight of 227.20 g/mol. Its IUPAC name is butane;phosphoric acid;prop-2-enamide.
Molecular Properties
| Compound Name | butane;phosphoric acid;prop-2-enamide |
| PubChem CID | 159316874 |
| Molecular Formula | C7H18NO5P |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | butane;phosphoric acid;prop-2-enamide |
| SMILES | C=CC(N)=O.CCCC.O=P(O)(O)O |
| InChI | InChI=1S/C4H10.C3H5NO.H3O4P/c1-3-4-2;1-2-3(4)5;1-5(2,3)4/h3-4H2,1-2H3;2H,1H2,(H2,4,5);(H3,1,2,3,4) |
| InChIKey | LDGCACGLZOCRKW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;phosphoric acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;phosphoric acid;prop-2-enamide?
The IUPAC name of butane;phosphoric acid;prop-2-enamide (CID 159316874) is butane;phosphoric acid;prop-2-enamide.
What is the SMILES notation for butane;phosphoric acid;prop-2-enamide?
The canonical SMILES for butane;phosphoric acid;prop-2-enamide is C=CC(N)=O.CCCC.O=P(O)(O)O.
What is the InChIKey of butane;phosphoric acid;prop-2-enamide?
The InChIKey is LDGCACGLZOCRKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H5NO.H3O4P/c1-3-4-2;1-2-3(4)5;1-5(2,3)4/h3-4H2,1-2H3;2H,1H2,(H2,4,5);(H3,1,2,3,4).
What are the key properties of butane;phosphoric acid;prop-2-enamide?
butane;phosphoric acid;prop-2-enamide has a molecular weight of 227.20 g/mol, XLogP of 0.54, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;phosphoric acid;prop-2-enamide is sourced from PubChem (CID 159316874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).