C11H23N3O2 — CID 158610265
N,N-dimethylpropan-1-amine;bis(prop-2-enamide) (PubChem CID 158610265) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;bis(prop-2-enamide).
| Compound Name | N,N-dimethylpropan-1-amine;bis(prop-2-enamide) |
|---|---|
| PubChem CID | 158610265 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N,N-dimethylpropan-1-amine;bis(prop-2-enamide) |
| SMILES | C=CC(N)=O.C=CC(N)=O.CCCN(C)C |
| InChI | InChI=1S/C5H13N.2C3H5NO/c1-4-5-6(2)3;2*1-2-3(4)5/h4-5H2,1-3H3;2*2H,1H2,(H2,4,5) |
| InChIKey | HWTDZOWZIWIHJH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|