C13H29N5O2 — CID 87098923
N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis(prop-2-enamide) (PubChem CID 87098923) has the molecular formula C13H29N5O2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis(prop-2-enamide).
| Compound Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis(prop-2-enamide) |
|---|---|
| PubChem CID | 87098923 |
| Molecular Formula | C13H29N5O2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;bis(prop-2-enamide) |
| SMILES | C=CC(N)=O.C=CC(N)=O.CN(CCCN)CCCN |
| InChI | InChI=1S/C7H19N3.2C3H5NO/c1-10(6-2-4-8)7-3-5-9;2*1-2-3(4)5/h2-9H2,1H3;2*2H,1H2,(H2,4,5) |
| InChIKey | XVEKDDLBPVNOSP-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|