C9H21N3O — CID 59112836
N-[3-[3-aminopropyl(methyl)amino]propyl]acetamide (PubChem CID 59112836) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is N-[3-[3-aminopropyl(methyl)amino]propyl]acetamide.
| Compound Name | N-[3-[3-aminopropyl(methyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 59112836 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N-[3-[3-aminopropyl(methyl)amino]propyl]acetamide |
| SMILES | CC(=O)NCCCN(C)CCCN |
| InChI | InChI=1S/C9H21N3O/c1-9(13)11-6-4-8-12(2)7-3-5-10/h3-8,10H2,1-2H3,(H,11,13) |
| InChIKey | QLTLIDUDFWWMJC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|