C11H28N4 — CID 71344458
N'-[3-[3-aminopropyl(methyl)amino]propyl]butane-1,4-diamine (PubChem CID 71344458) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is N'-[3-[3-aminopropyl(methyl)amino]propyl]butane-1,4-diamine.
| Compound Name | N'-[3-[3-aminopropyl(methyl)amino]propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 71344458 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | N'-[3-[3-aminopropyl(methyl)amino]propyl]butane-1,4-diamine |
| SMILES | CN(CCCN)CCCNCCCCN |
| InChI | InChI=1S/C11H28N4/c1-15(10-4-7-13)11-5-9-14-8-3-2-6-12/h14H,2-13H2,1H3 |
| InChIKey | CBWZICPRYCCBPO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|