C13H37N3 — CID 145215099
ethane;N'-[4-(ethylamino)butyl]-N'-methylbutane-1,4-diamine;molecular hydrogen (PubChem CID 145215099) has the molecular formula C13H37N3 and a molecular weight of 235.46 g/mol. Its IUPAC name is ethane;N'-[4-(ethylamino)butyl]-N'-methylbutane-1,4-diamine;molecular hydrogen.
| Compound Name | ethane;N'-[4-(ethylamino)butyl]-N'-methylbutane-1,4-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 145215099 |
| Molecular Formula | C13H37N3 |
| Molecular Weight | 235.46 g/mol |
| Exact Mass | 235.30 |
| IUPAC Name | ethane;N'-[4-(ethylamino)butyl]-N'-methylbutane-1,4-diamine;molecular hydrogen |
| SMILES | CC.CCNCCCCN(C)CCCCN.[H][H].[H][H] |
| InChI | InChI=1S/C11H27N3.C2H6.2H2/c1-3-13-9-5-7-11-14(2)10-6-4-8-12;1-2;;/h13H,3-12H2,1-2H3;1-2H3;2*1H |
| InChIKey | NMUPJOYUDBOETG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|