C8H21N3 — CID 57004343
N'-(2-aminoethyl)-N'-methylpentane-1,5-diamine (PubChem CID 57004343) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-methylpentane-1,5-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 57004343 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | N'-(2-aminoethyl)-N'-methylpentane-1,5-diamine |
| SMILES | CN(CCN)CCCCCN |
| InChI | InChI=1S/C8H21N3/c1-11(8-6-10)7-4-2-3-5-9/h2-10H2,1H3 |
| InChIKey | BIZMHXXYQHVBDS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|