C7H18N2 — CID 3465925
N',N'-dimethylpentane-1,5-diamine (PubChem CID 3465925) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is N',N'-dimethylpentane-1,5-diamine.
| Compound Name | N',N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 3465925 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | N',N'-dimethylpentane-1,5-diamine |
| SMILES | CN(C)CCCCCN |
| InChI | InChI=1S/C7H18N2/c1-9(2)7-5-3-4-6-8/h3-8H2,1-2H3 |
| InChIKey | ZQEQANWXEQSAGL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|