C30H66N2 — CID 88621765
N,N-dimethyldodecan-1-amine;14-methylpentadecan-1-amine (PubChem CID 88621765) has the molecular formula C30H66N2 and a molecular weight of 454.87 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;14-methylpentadecan-1-amine.
| Compound Name | N,N-dimethyldodecan-1-amine;14-methylpentadecan-1-amine |
|---|---|
| PubChem CID | 88621765 |
| Molecular Formula | C30H66N2 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.52 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;14-methylpentadecan-1-amine |
| SMILES | CC(C)CCCCCCCCCCCCCN.CCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C16H35N.C14H31N/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17;1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h16H,3-15,17H2,1-2H3;4-14H2,1-3H3 |
| InChIKey | WQRRWNNXYOVYCQ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|