C24H52ClN — CID 173055097
N,N,20-trimethylhenicosan-1-amine;hydrochloride (PubChem CID 173055097) has the molecular formula C24H52ClN and a molecular weight of 390.14 g/mol. Its IUPAC name is N,N,20-trimethylhenicosan-1-amine;hydrochloride.
| Compound Name | N,N,20-trimethylhenicosan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173055097 |
| Molecular Formula | C24H52ClN |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 389.38 |
| IUPAC Name | N,N,20-trimethylhenicosan-1-amine;hydrochloride |
| SMILES | CC(C)CCCCCCCCCCCCCCCCCCCN(C)C.Cl |
| InChI | InChI=1S/C24H51N.ClH/c1-24(2)22-20-18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-21-23-25(3)4;/h24H,5-23H2,1-4H3;1H |
| InChIKey | CTIIELQCBBRWQT-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|