C22H48N2 — CID 54351766
N',N'-dimethylicosane-1,20-diamine (PubChem CID 54351766) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is N',N'-dimethylicosane-1,20-diamine.
| Compound Name | N',N'-dimethylicosane-1,20-diamine |
|---|---|
| PubChem CID | 54351766 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | N',N'-dimethylicosane-1,20-diamine |
| SMILES | CN(C)CCCCCCCCCCCCCCCCCCCCN |
| InChI | InChI=1S/C22H48N2/c1-24(2)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23/h3-23H2,1-2H3 |
| InChIKey | UGGQNATXRBUISN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|